C27H25N3O6S — CID 19547465
(5E)-3-(4-ethoxyphenyl)-5-[[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19547465) has the molecular formula C27H25N3O6S and a molecular weight of 519.58 g/mol. Its IUPAC name is (5E)-3-(4-ethoxyphenyl)-5-[[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-(4-ethoxyphenyl)-5-[[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19547465 |
| Molecular Formula | C27H25N3O6S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | (5E)-3-(4-ethoxyphenyl)-5-[[4-methoxy-3-[(4-methyl-2-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C\c3ccc(OC)c(COc4ccc(C)cc4[N+](=O)[O-])c3)NC2=S)cc1 |
| InChI | InChI=1S/C27H25N3O6S/c1-4-35-21-9-7-20(8-10-21)29-26(31)22(28-27(29)37)15-18-6-12-24(34-3)19(14-18)16-36-25-11-5-17(2)13-23(25)30(32)33/h5-15H,4,16H2,1-3H3,(H,28,37)/b22-15+ |
| InChIKey | WNBPWIMXVOPSHH-PXLXIMEGSA-N |
| XLogP | 5.15 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|