C25H20FN3O6S — CID 19546846
(5E)-5-[[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546846) has the molecular formula C25H20FN3O6S and a molecular weight of 509.52 g/mol. Its IUPAC name is (5E)-5-[[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546846 |
| Molecular Formula | C25H20FN3O6S |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | (5E)-5-[[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(2-methoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(c3ccccc3OC)C2=O)cc1COc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H20FN3O6S/c1-33-21-10-7-15(11-16(21)14-35-23-13-17(26)8-9-20(23)29(31)32)12-18-24(30)28(25(36)27-18)19-5-3-4-6-22(19)34-2/h3-13H,14H2,1-2H3,(H,27,36)/b18-12+ |
| InChIKey | LZPMTFJQZPSQBO-LDADJPATSA-N |
| XLogP | 4.59 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|