C22H22FN3O6S — CID 19547300
(5E)-5-[[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19547300) has the molecular formula C22H22FN3O6S and a molecular weight of 475.50 g/mol. Its IUPAC name is (5E)-5-[[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19547300 |
| Molecular Formula | C22H22FN3O6S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | (5E)-5-[[3-[(5-fluoro-2-nitrophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COCCCN1C(=O)/C(=C\c2ccc(OC)c(COc3cc(F)ccc3[N+](=O)[O-])c2)NC1=S |
| InChI | InChI=1S/C22H22FN3O6S/c1-30-9-3-8-25-21(27)17(24-22(25)33)11-14-4-7-19(31-2)15(10-14)13-32-20-12-16(23)5-6-18(20)26(28)29/h4-7,10-12H,3,8-9,13H2,1-2H3,(H,24,33)/b17-11+ |
| InChIKey | ZWKGYEHBOATAHX-GZTJUZNOSA-N |
| XLogP | 3.42 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|