C26H26N2O4S — CID 19547232
(5E)-5-[[4-methoxy-3-(naphthalen-2-yloxymethyl)phenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19547232) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is (5E)-5-[[4-methoxy-3-(naphthalen-2-yloxymethyl)phenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[4-methoxy-3-(naphthalen-2-yloxymethyl)phenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19547232 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (5E)-5-[[4-methoxy-3-(naphthalen-2-yloxymethyl)phenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COCCCN1C(=O)/C(=C\c2ccc(OC)c(COc3ccc4ccccc4c3)c2)NC1=S |
| InChI | InChI=1S/C26H26N2O4S/c1-30-13-5-12-28-25(29)23(27-26(28)33)15-18-8-11-24(31-2)21(14-18)17-32-22-10-9-19-6-3-4-7-20(19)16-22/h3-4,6-11,14-16H,5,12-13,17H2,1-2H3,(H,27,33)/b23-15+ |
| InChIKey | QOCDHYRAFZBHDO-HZHRSRAPSA-N |
| XLogP | 4.52 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|