C25H26N4O4S — CID 19288322
(5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[[4-methoxy-3-[(4-methoxyphenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19288322) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is (5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[[4-methoxy-3-[(4-methoxyphenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[[4-methoxy-3-[(4-methoxyphenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19288322 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (5E)-3-[(1-ethylpyrazol-4-yl)methyl]-5-[[4-methoxy-3-[(4-methoxyphenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCn1cc(CN2C(=O)/C(=C\c3ccc(OC)c(COc4ccc(OC)cc4)c3)NC2=S)cn1 |
| InChI | InChI=1S/C25H26N4O4S/c1-4-28-14-18(13-26-28)15-29-24(30)22(27-25(29)34)12-17-5-10-23(32-3)19(11-17)16-33-21-8-6-20(31-2)7-9-21/h5-14H,4,15-16H2,1-3H3,(H,27,34)/b22-12+ |
| InChIKey | MDAPNQNXCVLJMD-WSDLNYQXSA-N |
| XLogP | 3.76 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|