C36H36N2O5S — CID 19288264
(5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(4-phenylphenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19288264) has the molecular formula C36H36N2O5S and a molecular weight of 608.76 g/mol. Its IUPAC name is (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(4-phenylphenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(4-phenylphenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19288264 |
| Molecular Formula | C36H36N2O5S |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | (5E)-3-[2-(3,4-diethoxyphenyl)ethyl]-5-[[4-methoxy-3-[(4-phenylphenoxy)methyl]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(CCN2C(=O)/C(=C\c3ccc(OC)c(COc4ccc(-c5ccccc5)cc4)c3)NC2=S)cc1OCC |
| InChI | InChI=1S/C36H36N2O5S/c1-4-41-33-18-11-25(23-34(33)42-5-2)19-20-38-35(39)31(37-36(38)44)22-26-12-17-32(40-3)29(21-26)24-43-30-15-13-28(14-16-30)27-9-7-6-8-10-27/h6-18,21-23H,4-5,19-20,24H2,1-3H3,(H,37,44)/b31-22+ |
| InChIKey | CYWKVSDIPMYJJB-DFKUXCBWSA-N |
| XLogP | 7.04 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|