C30H31BrN2O5S — CID 19288070
(5E)-5-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19288070) has the molecular formula C30H31BrN2O5S and a molecular weight of 611.56 g/mol. Its IUPAC name is (5E)-5-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19288070 |
| Molecular Formula | C30H31BrN2O5S |
| Molecular Weight | 611.56 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | (5E)-5-[[3-[(2-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(CCN2C(=O)/C(=C\c3ccc(OC)c(COc4ccccc4Br)c3)NC2=S)cc1OCC |
| InChI | InChI=1S/C30H31BrN2O5S/c1-4-36-27-13-10-20(18-28(27)37-5-2)14-15-33-29(34)24(32-30(33)39)17-21-11-12-25(35-3)22(16-21)19-38-26-9-7-6-8-23(26)31/h6-13,16-18H,4-5,14-15,19H2,1-3H3,(H,32,39)/b24-17+ |
| InChIKey | XKTGZAQEYIIGKG-JJIBRWJFSA-N |
| XLogP | 6.13 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|