C21H26N4O3S — CID 19547282
(5E)-5-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19547282) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is (5E)-5-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19547282 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (5E)-5-[[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylidene]-3-(3-methoxypropyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COCCCN1C(=O)/C(=C\c2ccc(OC)c(Cn3nc(C)cc3C)c2)NC1=S |
| InChI | InChI=1S/C21H26N4O3S/c1-14-10-15(2)25(23-14)13-17-11-16(6-7-19(17)28-4)12-18-20(26)24(21(29)22-18)8-5-9-27-3/h6-7,10-12H,5,8-9,13H2,1-4H3,(H,22,29)/b18-12+ |
| InChIKey | GXCXDRBJUOBTQO-LDADJPATSA-N |
| XLogP | 2.65 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|