C21H19BrN4O3S — CID 19289786
(5E)-5-[[5-[(3-bromophenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19289786) has the molecular formula C21H19BrN4O3S and a molecular weight of 487.38 g/mol. Its IUPAC name is (5E)-5-[[5-[(3-bromophenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(3-bromophenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19289786 |
| Molecular Formula | C21H19BrN4O3S |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | (5E)-5-[[5-[(3-bromophenoxy)methyl]furan-2-yl]methylidene]-3-[(1-ethylpyrazol-4-yl)methyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCn1cc(CN2C(=O)/C(=C\c3ccc(COc4cccc(Br)c4)o3)NC2=S)cn1 |
| InChI | InChI=1S/C21H19BrN4O3S/c1-2-25-11-14(10-23-25)12-26-20(27)19(24-21(26)30)9-17-6-7-18(29-17)13-28-16-5-3-4-15(22)8-16/h3-11H,2,12-13H2,1H3,(H,24,30)/b19-9+ |
| InChIKey | UCWVZQKTXINHKV-DJKKODMXSA-N |
| XLogP | 4.10 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|