C19H17BrN2O3 — CID 19543483
(E)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]-1-(1-ethylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 19543483) has the molecular formula C19H17BrN2O3 and a molecular weight of 401.26 g/mol. Its IUPAC name is (E)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]-1-(1-ethylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]-1-(1-ethylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19543483 |
| Molecular Formula | C19H17BrN2O3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (E)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]-1-(1-ethylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | CCn1cc(C(=O)/C=C/c2ccc(COc3cccc(Br)c3)o2)cn1 |
| InChI | InChI=1S/C19H17BrN2O3/c1-2-22-12-14(11-21-22)19(23)9-8-16-6-7-18(25-16)13-24-17-5-3-4-15(20)10-17/h3-12H,2,13H2,1H3/b9-8+ |
| InChIKey | KTUDFBQFSYIOLM-CMDGGOBGSA-N |
| XLogP | 4.73 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|