C21H21ClN2O3 — CID 19553184
(E)-3-[5-[(4-chloro-3,5-dimethylphenoxy)methyl]furan-2-yl]-1-(2-ethylpyrazol-3-yl)prop-2-en-1-one (PubChem CID 19553184) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is (E)-3-[5-[(4-chloro-3,5-dimethylphenoxy)methyl]furan-2-yl]-1-(2-ethylpyrazol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-chloro-3,5-dimethylphenoxy)methyl]furan-2-yl]-1-(2-ethylpyrazol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19553184 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (E)-3-[5-[(4-chloro-3,5-dimethylphenoxy)methyl]furan-2-yl]-1-(2-ethylpyrazol-3-yl)prop-2-en-1-one |
| SMILES | CCn1nccc1C(=O)/C=C/c1ccc(COc2cc(C)c(Cl)c(C)c2)o1 |
| InChI | InChI=1S/C21H21ClN2O3/c1-4-24-19(9-10-23-24)20(25)8-7-16-5-6-17(27-16)13-26-18-11-14(2)21(22)15(3)12-18/h5-12H,4,13H2,1-3H3/b8-7+ |
| InChIKey | BQXGYMSIVPFQQX-BQYQJAHWSA-N |
| XLogP | 5.24 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|