C19H14F4N2O3 — CID 19553198
(E)-1-(2-ethylpyrazol-3-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19553198) has the molecular formula C19H14F4N2O3 and a molecular weight of 394.32 g/mol. Its IUPAC name is (E)-1-(2-ethylpyrazol-3-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2-ethylpyrazol-3-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19553198 |
| Molecular Formula | C19H14F4N2O3 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (E)-1-(2-ethylpyrazol-3-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | CCn1nccc1C(=O)/C=C/c1ccc(COc2c(F)c(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C19H14F4N2O3/c1-2-25-15(7-8-24-25)16(26)6-5-11-3-4-12(28-11)10-27-19-17(22)13(20)9-14(21)18(19)23/h3-9H,2,10H2,1H3/b6-5+ |
| InChIKey | UXLCEBKWHWXQGJ-AATRIKPKSA-N |
| XLogP | 4.53 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|