C18H12F4N2O3 — CID 19565427
(E)-1-(1-methylpyrazol-3-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19565427) has the molecular formula C18H12F4N2O3 and a molecular weight of 380.30 g/mol. Its IUPAC name is (E)-1-(1-methylpyrazol-3-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-methylpyrazol-3-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19565427 |
| Molecular Formula | C18H12F4N2O3 |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (E)-1-(1-methylpyrazol-3-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | Cn1ccc(C(=O)/C=C/c2ccc(COc3c(F)c(F)cc(F)c3F)o2)n1 |
| InChI | InChI=1S/C18H12F4N2O3/c1-24-7-6-14(23-24)15(25)5-4-10-2-3-11(27-10)9-26-18-16(21)12(19)8-13(20)17(18)22/h2-8H,9H2,1H3/b5-4+ |
| InChIKey | DLMQRXAYXPHURN-SNAWJCMRSA-N |
| XLogP | 4.04 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|