C24H22F4O3 — CID 19571233
(E)-1-(1-adamantyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19571233) has the molecular formula C24H22F4O3 and a molecular weight of 434.43 g/mol. Its IUPAC name is (E)-1-(1-adamantyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-adamantyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19571233 |
| Molecular Formula | C24H22F4O3 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (E)-1-(1-adamantyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2c(F)c(F)cc(F)c2F)o1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H22F4O3/c25-18-8-19(26)22(28)23(21(18)27)30-12-17-2-1-16(31-17)3-4-20(29)24-9-13-5-14(10-24)7-15(6-13)11-24/h1-4,8,13-15H,5-7,9-12H2/b4-3+ |
| InChIKey | ZQXYVLIDKNPOMH-ONEGZZNKSA-N |
| XLogP | 6.21 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|