C15H13F4NO3 — CID 19457280
N-propan-2-yl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19457280) has the molecular formula C15H13F4NO3 and a molecular weight of 331.27 g/mol. Its IUPAC name is N-propan-2-yl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-propan-2-yl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19457280 |
| Molecular Formula | C15H13F4NO3 |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-propan-2-yl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CC(C)NC(=O)c1ccc(COc2c(F)c(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C15H13F4NO3/c1-7(2)20-15(21)11-4-3-8(23-11)6-22-14-12(18)9(16)5-10(17)13(14)19/h3-5,7H,6H2,1-2H3,(H,20,21) |
| InChIKey | ICUJGUUBIRKXTO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|