C22H18F5NO5 — CID 19461453
N-[1-(2,5-dimethoxyphenyl)ethyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461453) has the molecular formula C22H18F5NO5 and a molecular weight of 471.38 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)ethyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461453 |
| Molecular Formula | C22H18F5NO5 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)c2ccc(COc3c(F)c(F)c(F)c(F)c3F)o2)c1 |
| InChI | InChI=1S/C22H18F5NO5/c1-10(13-8-11(30-2)4-6-14(13)31-3)28-22(29)15-7-5-12(33-15)9-32-21-19(26)17(24)16(23)18(25)20(21)27/h4-8,10H,9H2,1-3H3,(H,28,29) |
| InChIKey | CYTXKLASHCYXSJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|