C18H8ClF6NO3 — CID 3242441
N-(4-chloro-2-fluorophenyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 3242441) has the molecular formula C18H8ClF6NO3 and a molecular weight of 435.71 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3242441 |
| Molecular Formula | C18H8ClF6NO3 |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)c1ccc(COc2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C18H8ClF6NO3/c19-7-1-3-10(9(20)5-7)26-18(27)11-4-2-8(29-11)6-28-17-15(24)13(22)12(21)14(23)16(17)25/h1-5H,6H2,(H,26,27) |
| InChIKey | IVCNKRXNAIYUKI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|