C22H13ClF5N3O3 — CID 19283770
N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19283770) has the molecular formula C22H13ClF5N3O3 and a molecular weight of 497.81 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19283770 |
| Molecular Formula | C22H13ClF5N3O3 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2ccc(Cl)cc2)n1)c1ccc(COc2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C22H13ClF5N3O3/c23-12-3-1-11(2-4-12)9-31-8-7-15(30-31)29-22(32)14-6-5-13(34-14)10-33-21-19(27)17(25)16(24)18(26)20(21)28/h1-8H,9-10H2,(H,29,30,32) |
| InChIKey | PWGMOCSHSJUGEC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|