C22H15F5N4O3 — CID 19461464
N-[1-[(4-methylphenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461464) has the molecular formula C22H15F5N4O3 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-[1-[(4-methylphenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(4-methylphenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461464 |
| Molecular Formula | C22H15F5N4O3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N-[1-[(4-methylphenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(Cn2cnc(NC(=O)c3ccc(COc4c(F)c(F)c(F)c(F)c4F)o3)n2)cc1 |
| InChI | InChI=1S/C22H15F5N4O3/c1-11-2-4-12(5-3-11)8-31-10-28-22(30-31)29-21(32)14-7-6-13(34-14)9-33-20-18(26)16(24)15(23)17(25)19(20)27/h2-7,10H,8-9H2,1H3,(H,29,30,32) |
| InChIKey | RDAVUMSZXVGNHH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|