C21H11Cl2F5N4O3 — CID 19461476
N-[1-[(2,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461476) has the molecular formula C21H11Cl2F5N4O3 and a molecular weight of 533.24 g/mol. Its IUPAC name is N-[1-[(2,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(2,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461476 |
| Molecular Formula | C21H11Cl2F5N4O3 |
| Molecular Weight | 533.24 g/mol |
| Exact Mass | 532.01 |
| IUPAC Name | N-[1-[(2,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ncn(Cc2ccc(Cl)cc2Cl)n1)c1ccc(COc2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C21H11Cl2F5N4O3/c22-10-2-1-9(12(23)5-10)6-32-8-29-21(31-32)30-20(33)13-4-3-11(35-13)7-34-19-17(27)15(25)14(24)16(26)18(19)28/h1-5,8H,6-7H2,(H,30,31,33) |
| InChIKey | MDAOFSPKTMWZEY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.24 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|