C20H12F7NO4 — CID 19461448
N-[2-(difluoromethoxy)-4-methylphenyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461448) has the molecular formula C20H12F7NO4 and a molecular weight of 463.31 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-4-methylphenyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[2-(difluoromethoxy)-4-methylphenyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461448 |
| Molecular Formula | C20H12F7NO4 |
| Molecular Weight | 463.31 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | N-[2-(difluoromethoxy)-4-methylphenyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(COc3c(F)c(F)c(F)c(F)c3F)o2)c(OC(F)F)c1 |
| InChI | InChI=1S/C20H12F7NO4/c1-8-2-4-10(12(6-8)32-20(26)27)28-19(29)11-5-3-9(31-11)7-30-18-16(24)14(22)13(21)15(23)17(18)25/h2-6,20H,7H2,1H3,(H,28,29) |
| InChIKey | CCIFXJWQPBKVIO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.31 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|