C19H22F2N2O3 — CID 19416022
N-[2-(difluoromethoxy)-4-methylphenyl]-5-(piperidin-1-ylmethyl)furan-2-carboxamide (PubChem CID 19416022) has the molecular formula C19H22F2N2O3 and a molecular weight of 364.39 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-4-methylphenyl]-5-(piperidin-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[2-(difluoromethoxy)-4-methylphenyl]-5-(piperidin-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19416022 |
| Molecular Formula | C19H22F2N2O3 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[2-(difluoromethoxy)-4-methylphenyl]-5-(piperidin-1-ylmethyl)furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCCCC3)o2)c(OC(F)F)c1 |
| InChI | InChI=1S/C19H22F2N2O3/c1-13-5-7-15(17(11-13)26-19(20)21)22-18(24)16-8-6-14(25-16)12-23-9-3-2-4-10-23/h5-8,11,19H,2-4,9-10,12H2,1H3,(H,22,24) |
| InChIKey | BNRLPIUNLGCCLZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |