C22H19F2NO5 — CID 19455292
5-[(4-acetylphenoxy)methyl]-N-[2-(difluoromethoxy)-4-methylphenyl]furan-2-carboxamide (PubChem CID 19455292) has the molecular formula C22H19F2NO5 and a molecular weight of 415.39 g/mol. Its IUPAC name is 5-[(4-acetylphenoxy)methyl]-N-[2-(difluoromethoxy)-4-methylphenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-acetylphenoxy)methyl]-N-[2-(difluoromethoxy)-4-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19455292 |
| Molecular Formula | C22H19F2NO5 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 5-[(4-acetylphenoxy)methyl]-N-[2-(difluoromethoxy)-4-methylphenyl]furan-2-carboxamide |
| SMILES | CC(=O)c1ccc(OCc2ccc(C(=O)Nc3ccc(C)cc3OC(F)F)o2)cc1 |
| InChI | InChI=1S/C22H19F2NO5/c1-13-3-9-18(20(11-13)30-22(23)24)25-21(27)19-10-8-17(29-19)12-28-16-6-4-15(5-7-16)14(2)26/h3-11,22H,12H2,1-2H3,(H,25,27) |
| InChIKey | QULKWKJWPDOVIR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |