C24H25F2NO4 — CID 19452486
5-[(4-tert-butylphenoxy)methyl]-N-[4-(difluoromethoxy)-2-methylphenyl]furan-2-carboxamide (PubChem CID 19452486) has the molecular formula C24H25F2NO4 and a molecular weight of 429.46 g/mol. Its IUPAC name is 5-[(4-tert-butylphenoxy)methyl]-N-[4-(difluoromethoxy)-2-methylphenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-tert-butylphenoxy)methyl]-N-[4-(difluoromethoxy)-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19452486 |
| Molecular Formula | C24H25F2NO4 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 5-[(4-tert-butylphenoxy)methyl]-N-[4-(difluoromethoxy)-2-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1cc(OC(F)F)ccc1NC(=O)c1ccc(COc2ccc(C(C)(C)C)cc2)o1 |
| InChI | InChI=1S/C24H25F2NO4/c1-15-13-18(31-23(25)26)9-11-20(15)27-22(28)21-12-10-19(30-21)14-29-17-7-5-16(6-8-17)24(2,3)4/h5-13,23H,14H2,1-4H3,(H,27,28) |
| InChIKey | WUKYTIJLNGQDJF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |