C20H16BrF2NO4 — CID 19450342
5-[(2-bromophenoxy)methyl]-N-[4-(difluoromethoxy)-2-methylphenyl]furan-2-carboxamide (PubChem CID 19450342) has the molecular formula C20H16BrF2NO4 and a molecular weight of 452.25 g/mol. Its IUPAC name is 5-[(2-bromophenoxy)methyl]-N-[4-(difluoromethoxy)-2-methylphenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-bromophenoxy)methyl]-N-[4-(difluoromethoxy)-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19450342 |
| Molecular Formula | C20H16BrF2NO4 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 5-[(2-bromophenoxy)methyl]-N-[4-(difluoromethoxy)-2-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1cc(OC(F)F)ccc1NC(=O)c1ccc(COc2ccccc2Br)o1 |
| InChI | InChI=1S/C20H16BrF2NO4/c1-12-10-13(28-20(22)23)6-8-16(12)24-19(25)18-9-7-14(27-18)11-26-17-5-3-2-4-15(17)21/h2-10,20H,11H2,1H3,(H,24,25) |
| InChIKey | ZKEIAYHJWRAICT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |