C23H23NO7 — CID 55917140
methyl 2-[4-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]-3-methylphenoxy]acetate (PubChem CID 55917140) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is methyl 2-[4-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]-3-methylphenoxy]acetate.
| Compound Name | methyl 2-[4-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]-3-methylphenoxy]acetate |
|---|---|
| PubChem CID | 55917140 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | methyl 2-[4-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]-3-methylphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)c2ccc(COc3ccccc3OC)o2)c(C)c1 |
| InChI | InChI=1S/C23H23NO7/c1-15-12-16(29-14-22(25)28-3)8-10-18(15)24-23(26)21-11-9-17(31-21)13-30-20-7-5-4-6-19(20)27-2/h4-12H,13-14H2,1-3H3,(H,24,26) |
| InChIKey | KWQPETLQZCTDMR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |