C22H20BrNO6 — CID 55917271
methyl 2-[4-[[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]amino]-3-methylphenoxy]acetate (PubChem CID 55917271) has the molecular formula C22H20BrNO6 and a molecular weight of 474.31 g/mol. Its IUPAC name is methyl 2-[4-[[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]amino]-3-methylphenoxy]acetate.
| Compound Name | methyl 2-[4-[[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]amino]-3-methylphenoxy]acetate |
|---|---|
| PubChem CID | 55917271 |
| Molecular Formula | C22H20BrNO6 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | methyl 2-[4-[[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]amino]-3-methylphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)c2ccc(COc3cccc(Br)c3)o2)c(C)c1 |
| InChI | InChI=1S/C22H20BrNO6/c1-14-10-17(29-13-21(25)27-2)6-8-19(14)24-22(26)20-9-7-18(30-20)12-28-16-5-3-4-15(23)11-16/h3-11H,12-13H2,1-2H3,(H,24,26) |
| InChIKey | POTWVZIQCXTUHW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |