C21H18BrNO6 — CID 55779946
methyl 2-[4-[[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]amino]phenoxy]acetate (PubChem CID 55779946) has the molecular formula C21H18BrNO6 and a molecular weight of 460.28 g/mol. Its IUPAC name is methyl 2-[4-[[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 55779946 |
| Molecular Formula | C21H18BrNO6 |
| Molecular Weight | 460.28 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | methyl 2-[4-[[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)c2ccc(COc3cccc(Br)c3)o2)cc1 |
| InChI | InChI=1S/C21H18BrNO6/c1-26-20(24)13-28-16-7-5-15(6-8-16)23-21(25)19-10-9-18(29-19)12-27-17-4-2-3-14(22)11-17/h2-11H,12-13H2,1H3,(H,23,25) |
| InChIKey | NKCXKXVHSOXNSX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |