C21H19FN2O5 — CID 46666068
5-[(4-fluorophenoxy)methyl]-N-[4-[(2-methoxyacetyl)amino]phenyl]furan-2-carboxamide (PubChem CID 46666068) has the molecular formula C21H19FN2O5 and a molecular weight of 398.39 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-[4-[(2-methoxyacetyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-[4-[(2-methoxyacetyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46666068 |
| Molecular Formula | C21H19FN2O5 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-[4-[(2-methoxyacetyl)amino]phenyl]furan-2-carboxamide |
| SMILES | COCC(=O)Nc1ccc(NC(=O)c2ccc(COc3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C21H19FN2O5/c1-27-13-20(25)23-15-4-6-16(7-5-15)24-21(26)19-11-10-18(29-19)12-28-17-8-2-14(22)3-9-17/h2-11H,12-13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | PZWKINXKKCMYLX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |