C20H19FN2O3 — CID 78776389
N-[4-(dimethylamino)phenyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 78776389) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78776389 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc(COc3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C20H19FN2O3/c1-23(2)16-7-5-15(6-8-16)22-20(24)19-12-11-18(26-19)13-25-17-9-3-14(21)4-10-17/h3-12H,13H2,1-2H3,(H,22,24) |
| InChIKey | OCYACIZBATVBKI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|