C20H12Cl5F2NO4 — CID 19465916
N-[4-(difluoromethoxy)-2-methylphenyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19465916) has the molecular formula C20H12Cl5F2NO4 and a molecular weight of 545.58 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-2-methylphenyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)-2-methylphenyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19465916 |
| Molecular Formula | C20H12Cl5F2NO4 |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 542.92 |
| IUPAC Name | N-[4-(difluoromethoxy)-2-methylphenyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(OC(F)F)ccc1NC(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C20H12Cl5F2NO4/c1-8-6-9(32-20(26)27)2-4-11(8)28-19(29)12-5-3-10(31-12)7-30-18-16(24)14(22)13(21)15(23)17(18)25/h2-6,20H,7H2,1H3,(H,28,29) |
| InChIKey | PSGXIGHVCJHNKZ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|