C22H11Cl5F2N2O4S — CID 19465933
N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19465933) has the molecular formula C22H11Cl5F2N2O4S and a molecular weight of 614.67 g/mol. Its IUPAC name is N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19465933 |
| Molecular Formula | C22H11Cl5F2N2O4S |
| Molecular Weight | 614.67 g/mol |
| Exact Mass | 611.89 |
| IUPAC Name | N-[4-[4-(difluoromethoxy)phenyl]-1,3-thiazol-2-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(OC(F)F)cc2)cs1)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C22H11Cl5F2N2O4S/c23-14-15(24)17(26)19(18(27)16(14)25)33-7-11-5-6-13(34-11)20(32)31-22-30-12(8-36-22)9-1-3-10(4-2-9)35-21(28)29/h1-6,8,21H,7H2,(H,30,31,32) |
| InChIKey | SYSFRIQKDXDZSE-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.67 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|