C20H9F7N2O4S — CID 19461491
N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461491) has the molecular formula C20H9F7N2O4S and a molecular weight of 506.36 g/mol. Its IUPAC name is N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461491 |
| Molecular Formula | C20H9F7N2O4S |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1nc2ccc(OC(F)F)cc2s1)c1ccc(COc2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C20H9F7N2O4S/c21-12-13(22)15(24)17(16(25)14(12)23)31-6-8-2-4-10(32-8)18(30)29-20-28-9-3-1-7(33-19(26)27)5-11(9)34-20/h1-5,19H,6H2,(H,28,29,30) |
| InChIKey | PCHOWPIPPQJJJZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|