C21H15F2N3O6S — CID 19461707
N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461707) has the molecular formula C21H15F2N3O6S and a molecular weight of 475.43 g/mol. Its IUPAC name is N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461707 |
| Molecular Formula | C21H15F2N3O6S |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)Nc3nc4ccc(OC(F)F)cc4s3)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H15F2N3O6S/c1-11-8-12(3-6-16(11)26(28)29)30-10-14-4-7-17(31-14)19(27)25-21-24-15-5-2-13(32-20(22)23)9-18(15)33-21/h2-9,20H,10H2,1H3,(H,24,25,27) |
| InChIKey | MNSFNOKDTGPFLG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|