C18H10Cl5NO3 — CID 19465856
5-[(2,3,4,5,6-pentachlorophenoxy)methyl]-N-phenylfuran-2-carboxamide (PubChem CID 19465856) has the molecular formula C18H10Cl5NO3 and a molecular weight of 465.55 g/mol. Its IUPAC name is 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]-N-phenylfuran-2-carboxamide.
| Compound Name | 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]-N-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 19465856 |
| Molecular Formula | C18H10Cl5NO3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 462.91 |
| IUPAC Name | 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]-N-phenylfuran-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C18H10Cl5NO3/c19-12-13(20)15(22)17(16(23)14(12)21)26-8-10-6-7-11(27-10)18(25)24-9-4-2-1-3-5-9/h1-7H,8H2,(H,24,25) |
| InChIKey | MEILXMNLKKBWNN-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|