C24H16Cl5N3O5 — CID 19402390
methyl 2-[[4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazol-1-yl]methyl]benzoate (PubChem CID 19402390) has the molecular formula C24H16Cl5N3O5 and a molecular weight of 603.67 g/mol. Its IUPAC name is methyl 2-[[4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19402390 |
| Molecular Formula | C24H16Cl5N3O5 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 600.95 |
| IUPAC Name | methyl 2-[[4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1Cn1cc(NC(=O)c2ccc(COc3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)o2)cn1 |
| InChI | InChI=1S/C24H16Cl5N3O5/c1-35-24(34)15-5-3-2-4-12(15)9-32-10-13(8-30-32)31-23(33)16-7-6-14(37-16)11-36-22-20(28)18(26)17(25)19(27)21(22)29/h2-8,10H,9,11H2,1H3,(H,31,33) |
| InChIKey | DYFIGSBENIHSIS-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|