C24H18Cl5N3O4 — CID 19406511
N-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19406511) has the molecular formula C24H18Cl5N3O4 and a molecular weight of 589.69 g/mol. Its IUPAC name is N-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19406511 |
| Molecular Formula | C24H18Cl5N3O4 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 586.97 |
| IUPAC Name | N-[1-[(4-ethylphenoxy)methyl]pyrazol-4-yl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCc1ccc(OCn2cc(NC(=O)c3ccc(COc4c(Cl)c(Cl)c(Cl)c(Cl)c4Cl)o3)cn2)cc1 |
| InChI | InChI=1S/C24H18Cl5N3O4/c1-2-13-3-5-15(6-4-13)35-12-32-10-14(9-30-32)31-24(33)17-8-7-16(36-17)11-34-23-21(28)19(26)18(25)20(27)22(23)29/h3-10H,2,11-12H2,1H3,(H,31,33) |
| InChIKey | WPRJNTGDYQIEQS-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|