C28H25N3O3 — CID 19397913
5-[(4-ethylphenoxy)methyl]-N-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]furan-2-carboxamide (PubChem CID 19397913) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 5-[(4-ethylphenoxy)methyl]-N-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]furan-2-carboxamide.
| Compound Name | 5-[(4-ethylphenoxy)methyl]-N-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19397913 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 5-[(4-ethylphenoxy)methyl]-N-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]furan-2-carboxamide |
| SMILES | CCc1ccc(OCc2ccc(C(=O)Nc3cnn(Cc4cccc5ccccc45)c3)o2)cc1 |
| InChI | InChI=1S/C28H25N3O3/c1-2-20-10-12-24(13-11-20)33-19-25-14-15-27(34-25)28(32)30-23-16-29-31(18-23)17-22-8-5-7-21-6-3-4-9-26(21)22/h3-16,18H,2,17,19H2,1H3,(H,30,32) |
| InChIKey | DXNWIKZZMJBIPD-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |