C15H12Cl5NO3 — CID 19465878
5-[(2,3,4,5,6-pentachlorophenoxy)methyl]-N-propylfuran-2-carboxamide (PubChem CID 19465878) has the molecular formula C15H12Cl5NO3 and a molecular weight of 431.53 g/mol. Its IUPAC name is 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]-N-propylfuran-2-carboxamide.
| Compound Name | 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]-N-propylfuran-2-carboxamide |
|---|---|
| PubChem CID | 19465878 |
| Molecular Formula | C15H12Cl5NO3 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 428.93 |
| IUPAC Name | 5-[(2,3,4,5,6-pentachlorophenoxy)methyl]-N-propylfuran-2-carboxamide |
| SMILES | CCCNC(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C15H12Cl5NO3/c1-2-5-21-15(22)8-4-3-7(24-8)6-23-14-12(19)10(17)9(16)11(18)13(14)20/h3-4H,2,5-6H2,1H3,(H,21,22) |
| InChIKey | IQLOPRQIBKBRPT-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|