C18H14Cl5N3O3 — CID 19288518
N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19288518) has the molecular formula C18H14Cl5N3O3 and a molecular weight of 497.59 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19288518 |
| Molecular Formula | C18H14Cl5N3O3 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 494.95 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1nn(C)cc1CNC(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C18H14Cl5N3O3/c1-8-9(6-26(2)25-8)5-24-18(27)11-4-3-10(29-11)7-28-17-15(22)13(20)12(19)14(21)16(17)23/h3-4,6H,5,7H2,1-2H3,(H,24,27) |
| InChIKey | JHEKHOZMHLFVGO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|