C22H17Cl5N6O4 — CID 19336893
1-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide (PubChem CID 19336893) has the molecular formula C22H17Cl5N6O4 and a molecular weight of 606.68 g/mol. Its IUPAC name is 1-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19336893 |
| Molecular Formula | C22H17Cl5N6O4 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 603.98 |
| IUPAC Name | 1-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide |
| SMILES | Cn1cc(CNC(=O)c2c(NC(=O)c3ccc(COc4c(Cl)c(Cl)c(Cl)c(Cl)c4Cl)o3)cnn2C)cn1 |
| InChI | InChI=1S/C22H17Cl5N6O4/c1-32-8-10(6-29-32)5-28-22(35)19-12(7-30-33(19)2)31-21(34)13-4-3-11(37-13)9-36-20-17(26)15(24)14(23)16(25)18(20)27/h3-4,6-8H,5,9H2,1-2H3,(H,28,35)(H,31,34) |
| InChIKey | UBFRDTHVCARQKP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|