C17H11Cl5N4O4 — CID 19412346
1-methyl-4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide (PubChem CID 19412346) has the molecular formula C17H11Cl5N4O4 and a molecular weight of 512.56 g/mol. Its IUPAC name is 1-methyl-4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide.
| Compound Name | 1-methyl-4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19412346 |
| Molecular Formula | C17H11Cl5N4O4 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 509.92 |
| IUPAC Name | 1-methyl-4-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide |
| SMILES | Cn1ncc(NC(=O)c2ccc(COc3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)o2)c1C(N)=O |
| InChI | InChI=1S/C17H11Cl5N4O4/c1-26-14(16(23)27)7(4-24-26)25-17(28)8-3-2-6(30-8)5-29-15-12(21)10(19)9(18)11(20)13(15)22/h2-4H,5H2,1H3,(H2,23,27)(H,25,28) |
| InChIKey | RVUPXNKOYKCONA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|