C17H14BrN3O5 — CID 19406021
4-[[5-[(2-bromophenoxy)methyl]furan-2-carbonyl]amino]-1-methylpyrazole-5-carboxylic acid (PubChem CID 19406021) has the molecular formula C17H14BrN3O5 and a molecular weight of 420.22 g/mol. Its IUPAC name is 4-[[5-[(2-bromophenoxy)methyl]furan-2-carbonyl]amino]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-[[5-[(2-bromophenoxy)methyl]furan-2-carbonyl]amino]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19406021 |
| Molecular Formula | C17H14BrN3O5 |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 4-[[5-[(2-bromophenoxy)methyl]furan-2-carbonyl]amino]-1-methylpyrazole-5-carboxylic acid |
| SMILES | Cn1ncc(NC(=O)c2ccc(COc3ccccc3Br)o2)c1C(=O)O |
| InChI | InChI=1S/C17H14BrN3O5/c1-21-15(17(23)24)12(8-19-21)20-16(22)14-7-6-10(26-14)9-25-13-5-3-2-4-11(13)18/h2-8H,9H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | DQPJABVWJRTOKU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |