C21H23N5O6 — CID 17024108
1-methyl-N-(2-methylpropyl)-4-[[5-[(2-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide (PubChem CID 17024108) has the molecular formula C21H23N5O6 and a molecular weight of 441.44 g/mol. Its IUPAC name is 1-methyl-N-(2-methylpropyl)-4-[[5-[(2-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-(2-methylpropyl)-4-[[5-[(2-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 17024108 |
| Molecular Formula | C21H23N5O6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 1-methyl-N-(2-methylpropyl)-4-[[5-[(2-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxamide |
| SMILES | CC(C)CNC(=O)c1c(NC(=O)c2ccc(COc3ccccc3[N+](=O)[O-])o2)cnn1C |
| InChI | InChI=1S/C21H23N5O6/c1-13(2)10-22-21(28)19-15(11-23-25(19)3)24-20(27)18-9-8-14(32-18)12-31-17-7-5-4-6-16(17)26(29)30/h4-9,11,13H,10,12H2,1-3H3,(H,22,28)(H,24,27) |
| InChIKey | GEIXHBANCPOSSS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|