C22H23N5O7 — CID 19338875
N-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19338875) has the molecular formula C22H23N5O7 and a molecular weight of 469.45 g/mol. Its IUPAC name is N-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19338875 |
| Molecular Formula | C22H23N5O7 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCn1ncc(NC(=O)c2ccc(COc3ccccc3[N+](=O)[O-])o2)c1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H23N5O7/c1-2-26-20(22(29)25-9-11-32-12-10-25)16(13-23-26)24-21(28)19-8-7-15(34-19)14-33-18-6-4-3-5-17(18)27(30)31/h3-8,13H,2,9-12,14H2,1H3,(H,24,28) |
| InChIKey | PRMDEOYNSWMGPQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|