C17H16N4O5 — CID 19346038
N-(1,3-dimethylpyrazol-4-yl)-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19346038) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazol-4-yl)-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(1,3-dimethylpyrazol-4-yl)-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19346038 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-(1,3-dimethylpyrazol-4-yl)-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1nn(C)cc1NC(=O)c1ccc(COc2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C17H16N4O5/c1-11-13(9-20(2)19-11)18-17(22)16-8-7-12(26-16)10-25-15-6-4-3-5-14(15)21(23)24/h3-9H,10H2,1-2H3,(H,18,22) |
| InChIKey | YCDZJSFNRCANNG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|