C22H17ClN4O5 — CID 19400656
N-(1-benzyl-4-chloropyrazol-3-yl)-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19400656) has the molecular formula C22H17ClN4O5 and a molecular weight of 452.85 g/mol. Its IUPAC name is N-(1-benzyl-4-chloropyrazol-3-yl)-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(1-benzyl-4-chloropyrazol-3-yl)-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19400656 |
| Molecular Formula | C22H17ClN4O5 |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-(1-benzyl-4-chloropyrazol-3-yl)-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1nn(Cc2ccccc2)cc1Cl)c1ccc(COc2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C22H17ClN4O5/c23-17-13-26(12-15-6-2-1-3-7-15)25-21(17)24-22(28)20-11-10-16(32-20)14-31-19-9-5-4-8-18(19)27(29)30/h1-11,13H,12,14H2,(H,24,25,28) |
| InChIKey | QYZYHIJUAWSPPA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|