C23H20ClN3O4 — CID 19400726
N-(1-benzyl-4-chloropyrazol-3-yl)-5-[(4-methoxyphenoxy)methyl]furan-2-carboxamide (PubChem CID 19400726) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is N-(1-benzyl-4-chloropyrazol-3-yl)-5-[(4-methoxyphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(1-benzyl-4-chloropyrazol-3-yl)-5-[(4-methoxyphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19400726 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-(1-benzyl-4-chloropyrazol-3-yl)-5-[(4-methoxyphenoxy)methyl]furan-2-carboxamide |
| SMILES | COc1ccc(OCc2ccc(C(=O)Nc3nn(Cc4ccccc4)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C23H20ClN3O4/c1-29-17-7-9-18(10-8-17)30-15-19-11-12-21(31-19)23(28)25-22-20(24)14-27(26-22)13-16-5-3-2-4-6-16/h2-12,14H,13,15H2,1H3,(H,25,26,28) |
| InChIKey | UNSCKNWBOCCOMD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |