C22H14Cl4N4O5 — CID 19459583
N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19459583) has the molecular formula C22H14Cl4N4O5 and a molecular weight of 556.19 g/mol. Its IUPAC name is N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19459583 |
| Molecular Formula | C22H14Cl4N4O5 |
| Molecular Weight | 556.19 g/mol |
| Exact Mass | 553.97 |
| IUPAC Name | N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1nn(Cc2ccc(Cl)c(Cl)c2)cc1Cl)c1ccc(COc2cc([N+](=O)[O-])ccc2Cl)o1 |
| InChI | InChI=1S/C22H14Cl4N4O5/c23-15-4-1-12(7-17(15)25)9-29-10-18(26)21(28-29)27-22(31)19-6-3-14(35-19)11-34-20-8-13(30(32)33)2-5-16(20)24/h1-8,10H,9,11H2,(H,27,28,31) |
| InChIKey | NQHXXDZKRLRYGD-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.19 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|