C22H15Cl3N4O5 — CID 19459720
5-[(2-chloro-5-nitrophenoxy)methyl]-N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]furan-2-carboxamide (PubChem CID 19459720) has the molecular formula C22H15Cl3N4O5 and a molecular weight of 521.74 g/mol. Its IUPAC name is 5-[(2-chloro-5-nitrophenoxy)methyl]-N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]furan-2-carboxamide.
| Compound Name | 5-[(2-chloro-5-nitrophenoxy)methyl]-N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19459720 |
| Molecular Formula | C22H15Cl3N4O5 |
| Molecular Weight | 521.74 g/mol |
| Exact Mass | 520.01 |
| IUPAC Name | 5-[(2-chloro-5-nitrophenoxy)methyl]-N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccc(Cl)c(Cl)c2)c1)c1ccc(COc2cc([N+](=O)[O-])ccc2Cl)o1 |
| InChI | InChI=1S/C22H15Cl3N4O5/c23-17-4-1-13(7-19(17)25)10-28-11-14(9-26-28)27-22(30)20-6-3-16(34-20)12-33-21-8-15(29(31)32)2-5-18(21)24/h1-9,11H,10,12H2,(H,27,30) |
| InChIKey | SQUHJVKRFAPTEJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.74 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|